C56H64N2 — CID 11170198
2-N,3-N-bis[2,6-bis(4-tert-butylphenyl)phenyl]butane-2,3-diimine (PubChem CID 11170198) has the molecular formula C56H64N2 and a molecular weight of 765.14 g/mol. Its IUPAC name is 2-N,3-N-bis[2,6-bis(4-tert-butylphenyl)phenyl]butane-2,3-diimine.
| Compound Name | 2-N,3-N-bis[2,6-bis(4-tert-butylphenyl)phenyl]butane-2,3-diimine |
|---|---|
| PubChem CID | 11170198 |
| Molecular Formula | C56H64N2 |
| Molecular Weight | 765.14 g/mol |
| Exact Mass | 764.51 |
| IUPAC Name | 2-N,3-N-bis[2,6-bis(4-tert-butylphenyl)phenyl]butane-2,3-diimine |
| SMILES | CC(=N\c1c(-c2ccc(C(C)(C)C)cc2)cccc1-c1ccc(C(C)(C)C)cc1)/C(C)=N/c1c(-c2ccc(C(C)(C)C)cc2)cccc1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C56H64N2/c1-37(57-51-47(39-21-29-43(30-22-39)53(3,4)5)17-15-18-48(51)40-23-31-44(32-24-40)54(6,7)8)38(2)58-52-49(41-25-33-45(34-26-41)55(9,10)11)19-16-20-50(52)42-27-35-46(36-28-42)56(12,13)14/h15-36H,1-14H3/b57-37+,58-38+ |
| InChIKey | ZTXHSUWQFPYEDD-WRVBFVOHSA-N |
| XLogP | 16.43 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.14 |
| LogP ≤ 5 | 16.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|