C34H32O2 — CID 135067467
2,3-bis(4-tert-butylphenyl)anthracene-9,10-dione (PubChem CID 135067467) has the molecular formula C34H32O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is 2,3-bis(4-tert-butylphenyl)anthracene-9,10-dione.
| Compound Name | 2,3-bis(4-tert-butylphenyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 135067467 |
| Molecular Formula | C34H32O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 2,3-bis(4-tert-butylphenyl)anthracene-9,10-dione |
| SMILES | CC(C)(C)c1ccc(-c2cc3c(cc2-c2ccc(C(C)(C)C)cc2)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C34H32O2/c1-33(2,3)23-15-11-21(12-16-23)27-19-29-30(32(36)26-10-8-7-9-25(26)31(29)35)20-28(27)22-13-17-24(18-14-22)34(4,5)6/h7-20H,1-6H3 |
| InChIKey | YPKUXZJHDZTKAC-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|