C132H132N4O4 — CID 157366555
2,6-bis[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]anthracene-9,10-dione (PubChem CID 157366555) has the molecular formula C132H132N4O4 and a molecular weight of 1838.53 g/mol. Its IUPAC name is 2,6-bis[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]anthracene-9,10-dione.
| Compound Name | 2,6-bis[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 157366555 |
| Molecular Formula | C132H132N4O4 |
| Molecular Weight | 1838.53 g/mol |
| Exact Mass | 1837.02 |
| IUPAC Name | 2,6-bis[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]anthracene-9,10-dione |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(-c3ccc4c(c3)C(=O)c3ccc(-c5ccc(N(c6ccc(C(C)(C)C)cc6)c6ccc(C(C)(C)C)cc6)cc5)cc3C4=O)cc2)c2ccc(C(C)(C)C)cc2)cc1.CC(C)(C)c1ccc(N(c2ccc(-c3ccc4c(c3)C(=O)c3ccc(-c5ccc(N(c6ccc(C(C)(C)C)cc6)c6ccc(C(C)(C)C)cc6)cc5)cc3C4=O)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/2C66H66N2O2/c2*1-63(2,3)47-19-31-53(32-20-47)67(54-33-21-48(22-34-54)64(4,5)6)51-27-13-43(14-28-51)45-17-39-57-59(41-45)61(69)58-40-18-46(42-60(58)62(57)70)44-15-29-52(30-16-44)68(55-35-23-49(24-36-55)65(7,8)9)56-37-25-50(26-38-56)66(10,11)12/h2*13-42H,1-12H3 |
| InChIKey | BJGDFTMCJPSZHX-UHFFFAOYSA-N |
| XLogP | 35.85 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 140 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1838.53 |
| LogP ≤ 5 | 35.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|