C38H27NO2S — CID 89392584
5-[7-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-9-oxofluoren-2-yl]thiophene-2-carbaldehyde (PubChem CID 89392584) has the molecular formula C38H27NO2S and a molecular weight of 561.71 g/mol. Its IUPAC name is 5-[7-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-9-oxofluoren-2-yl]thiophene-2-carbaldehyde.
| Compound Name | 5-[7-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-9-oxofluoren-2-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 89392584 |
| Molecular Formula | C38H27NO2S |
| Molecular Weight | 561.71 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | 5-[7-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-9-oxofluoren-2-yl]thiophene-2-carbaldehyde |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(-c3ccc4c(c3)C(=O)c3cc(-c5ccc(C=O)s5)ccc3-4)cc2)cc1 |
| InChI | InChI=1S/C38H27NO2S/c1-24-3-11-29(12-4-24)39(30-13-5-25(2)6-14-30)31-15-7-26(8-16-31)27-9-18-33-34-19-10-28(37-20-17-32(23-40)42-37)22-36(34)38(41)35(33)21-27/h3-23H,1-2H3 |
| InChIKey | QQLMMUUDWLFEHW-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.71 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|