C36H26N2O4S — CID 132573122
5-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-4-oxopyrrolo[1,2-a]indol-6-yl]thiophene-2-carbaldehyde (PubChem CID 132573122) has the molecular formula C36H26N2O4S and a molecular weight of 582.68 g/mol. Its IUPAC name is 5-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-4-oxopyrrolo[1,2-a]indol-6-yl]thiophene-2-carbaldehyde.
| Compound Name | 5-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-4-oxopyrrolo[1,2-a]indol-6-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 132573122 |
| Molecular Formula | C36H26N2O4S |
| Molecular Weight | 582.68 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | 5-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-4-oxopyrrolo[1,2-a]indol-6-yl]thiophene-2-carbaldehyde |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc(-c3cc4n(c3)-c3ccc(-c5ccc(C=O)s5)cc3C4=O)cc2)cc1 |
| InChI | InChI=1S/C36H26N2O4S/c1-41-29-12-8-27(9-13-29)38(28-10-14-30(42-2)15-11-28)26-6-3-23(4-7-26)25-20-34-36(40)32-19-24(5-17-33(32)37(34)21-25)35-18-16-31(22-39)43-35/h3-22H,1-2H3 |
| InChIKey | MQMPGZOICAVQDT-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.68 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|