C32H23N3O2S2 — CID 137477240
2-[[5-[5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile (PubChem CID 137477240) has the molecular formula C32H23N3O2S2 and a molecular weight of 545.69 g/mol. Its IUPAC name is 2-[[5-[5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[5-[5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 137477240 |
| Molecular Formula | C32H23N3O2S2 |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | 2-[[5-[5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc(-c3ccc(-c4ccc(C=C(C#N)C#N)s4)s3)cc2)cc1 |
| InChI | InChI=1S/C32H23N3O2S2/c1-36-27-11-7-25(8-12-27)35(26-9-13-28(37-2)14-10-26)24-5-3-23(4-6-24)30-17-18-32(39-30)31-16-15-29(38-31)19-22(20-33)21-34/h3-19H,1-2H3 |
| InChIKey | XDZUDGXMSXLMGB-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 69.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|