C45H39N3S2 — CID 102033930
2-[[5-[5-[9,9-dibutyl-7-(N-phenylanilino)fluoren-2-yl]thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile (PubChem CID 102033930) has the molecular formula C45H39N3S2 and a molecular weight of 685.96 g/mol. Its IUPAC name is 2-[[5-[5-[9,9-dibutyl-7-(N-phenylanilino)fluoren-2-yl]thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[5-[5-[9,9-dibutyl-7-(N-phenylanilino)fluoren-2-yl]thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 102033930 |
| Molecular Formula | C45H39N3S2 |
| Molecular Weight | 685.96 g/mol |
| Exact Mass | 685.26 |
| IUPAC Name | 2-[[5-[5-[9,9-dibutyl-7-(N-phenylanilino)fluoren-2-yl]thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile |
| SMILES | CCCCC1(CCCC)c2cc(-c3ccc(-c4ccc(C=C(C#N)C#N)s4)s3)ccc2-c2ccc(N(c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C45H39N3S2/c1-3-5-25-45(26-6-4-2)40-28-33(42-23-24-44(50-42)43-22-19-37(49-43)27-32(30-46)31-47)17-20-38(40)39-21-18-36(29-41(39)45)48(34-13-9-7-10-14-34)35-15-11-8-12-16-35/h7-24,27-29H,3-6,25-26H2,1-2H3 |
| InChIKey | OMKDHWJRYJDLMS-UHFFFAOYSA-N |
| XLogP | 13.69 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.96 |
| LogP ≤ 5 | 13.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|