C35H33N3S — CID 138500682
2-[[4,4-dibutyl-6-(N-phenylanilino)indeno[1,2-b]thiophen-2-yl]methylidene]propanedinitrile (PubChem CID 138500682) has the molecular formula C35H33N3S and a molecular weight of 527.74 g/mol. Its IUPAC name is 2-[[4,4-dibutyl-6-(N-phenylanilino)indeno[1,2-b]thiophen-2-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[4,4-dibutyl-6-(N-phenylanilino)indeno[1,2-b]thiophen-2-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 138500682 |
| Molecular Formula | C35H33N3S |
| Molecular Weight | 527.74 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 2-[[4,4-dibutyl-6-(N-phenylanilino)indeno[1,2-b]thiophen-2-yl]methylidene]propanedinitrile |
| SMILES | CCCCC1(CCCC)c2cc(N(c3ccccc3)c3ccccc3)ccc2-c2sc(C=C(C#N)C#N)cc21 |
| InChI | InChI=1S/C35H33N3S/c1-3-5-19-35(20-6-4-2)32-22-29(38(27-13-9-7-10-14-27)28-15-11-8-12-16-28)17-18-31(32)34-33(35)23-30(39-34)21-26(24-36)25-37/h7-18,21-23H,3-6,19-20H2,1-2H3 |
| InChIKey | GFOAJMRHBXFSLO-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.74 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|