C31H23N3S — CID 138500679
2-[(E)-3-[4,4-dimethyl-6-(N-phenylanilino)indeno[1,2-b]thiophen-2-yl]prop-2-enylidene]propanedinitrile (PubChem CID 138500679) has the molecular formula C31H23N3S and a molecular weight of 469.61 g/mol. Its IUPAC name is 2-[(E)-3-[4,4-dimethyl-6-(N-phenylanilino)indeno[1,2-b]thiophen-2-yl]prop-2-enylidene]propanedinitrile.
| Compound Name | 2-[(E)-3-[4,4-dimethyl-6-(N-phenylanilino)indeno[1,2-b]thiophen-2-yl]prop-2-enylidene]propanedinitrile |
|---|---|
| PubChem CID | 138500679 |
| Molecular Formula | C31H23N3S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 2-[(E)-3-[4,4-dimethyl-6-(N-phenylanilino)indeno[1,2-b]thiophen-2-yl]prop-2-enylidene]propanedinitrile |
| SMILES | CC1(C)c2cc(N(c3ccccc3)c3ccccc3)ccc2-c2sc(/C=C/C=C(C#N)C#N)cc21 |
| InChI | InChI=1S/C31H23N3S/c1-31(2)28-18-25(34(23-11-5-3-6-12-23)24-13-7-4-8-14-24)16-17-27(28)30-29(31)19-26(35-30)15-9-10-22(20-32)21-33/h3-19H,1-2H3/b15-9+ |
| InChIKey | VJFYLSLNLUZQDU-OQLLNIDSSA-N |
| XLogP | 8.51 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|