C58H43N3O2 — CID 143197478
(2E,4E)-2-cyano-5-[4-(N-[9,9-dimethyl-7-[7-(N-phenylanilino)-9H-fluoren-2-yl]fluoren-2-yl]anilino)phenyl]penta-2,4-dienoic acid (PubChem CID 143197478) has the molecular formula C58H43N3O2 and a molecular weight of 814.00 g/mol. Its IUPAC name is (2E,4E)-2-cyano-5-[4-(N-[9,9-dimethyl-7-[7-(N-phenylanilino)-9H-fluoren-2-yl]fluoren-2-yl]anilino)phenyl]penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-2-cyano-5-[4-(N-[9,9-dimethyl-7-[7-(N-phenylanilino)-9H-fluoren-2-yl]fluoren-2-yl]anilino)phenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 143197478 |
| Molecular Formula | C58H43N3O2 |
| Molecular Weight | 814.00 g/mol |
| Exact Mass | 813.34 |
| IUPAC Name | (2E,4E)-2-cyano-5-[4-(N-[9,9-dimethyl-7-[7-(N-phenylanilino)-9H-fluoren-2-yl]fluoren-2-yl]anilino)phenyl]penta-2,4-dienoic acid |
| SMILES | CC1(C)c2cc(-c3ccc4c(c3)Cc3cc(N(c5ccccc5)c5ccccc5)ccc3-4)ccc2-c2ccc(N(c3ccccc3)c3ccc(/C=C/C=C(\C#N)C(=O)O)cc3)cc21 |
| InChI | InChI=1S/C58H43N3O2/c1-58(2)55-36-41(40-23-29-51-43(33-40)34-44-35-49(27-31-52(44)51)60(45-15-6-3-7-16-45)46-17-8-4-9-18-46)24-30-53(55)54-32-28-50(37-56(54)58)61(47-19-10-5-11-20-47)48-25-21-39(22-26-48)13-12-14-42(38-59)57(62)63/h3-33,35-37H,34H2,1-2H3,(H,62,63)/b13-12+,42-14+ |
| InChIKey | SVCNRSBFTNQWAQ-HQSDAGFHSA-N |
| XLogP | 14.72 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.00 |
| LogP ≤ 5 | 14.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|