C46H34N2O2 — CID 177444686
(2Z,4E)-2-cyano-5-[4-[4-[4-[4-(4-ethenyl-N-(4-ethenylphenyl)anilino)phenyl]phenyl]phenyl]phenyl]penta-2,4-dienoic acid (PubChem CID 177444686) has the molecular formula C46H34N2O2 and a molecular weight of 646.79 g/mol. Its IUPAC name is (2Z,4E)-2-cyano-5-[4-[4-[4-[4-(4-ethenyl-N-(4-ethenylphenyl)anilino)phenyl]phenyl]phenyl]phenyl]penta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-2-cyano-5-[4-[4-[4-[4-(4-ethenyl-N-(4-ethenylphenyl)anilino)phenyl]phenyl]phenyl]phenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 177444686 |
| Molecular Formula | C46H34N2O2 |
| Molecular Weight | 646.79 g/mol |
| Exact Mass | 646.26 |
| IUPAC Name | (2Z,4E)-2-cyano-5-[4-[4-[4-[4-(4-ethenyl-N-(4-ethenylphenyl)anilino)phenyl]phenyl]phenyl]phenyl]penta-2,4-dienoic acid |
| SMILES | C=Cc1ccc(N(c2ccc(C=C)cc2)c2ccc(-c3ccc(-c4ccc(-c5ccc(/C=C/C=C(/C#N)C(=O)O)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C46H34N2O2/c1-3-33-10-26-43(27-11-33)48(44-28-12-34(4-2)13-29-44)45-30-24-41(25-31-45)40-22-20-39(21-23-40)38-18-16-37(17-19-38)36-14-8-35(9-15-36)6-5-7-42(32-47)46(49)50/h3-31H,1-2H2,(H,49,50)/b6-5+,42-7- |
| InChIKey | VRSLJTGEJXGZTH-ZNOCNJQASA-N |
| XLogP | 11.99 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.79 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|