C16H17NO3 — CID 54015737
5-(4-butoxyphenyl)-2-cyanopenta-2,4-dienoic acid (PubChem CID 54015737) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 5-(4-butoxyphenyl)-2-cyanopenta-2,4-dienoic acid.
| Compound Name | 5-(4-butoxyphenyl)-2-cyanopenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 54015737 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 5-(4-butoxyphenyl)-2-cyanopenta-2,4-dienoic acid |
| SMILES | CCCCOc1ccc(C=CC=C(C#N)C(=O)O)cc1 |
| InChI | InChI=1S/C16H17NO3/c1-2-3-11-20-15-9-7-13(8-10-15)5-4-6-14(12-17)16(18)19/h4-10H,2-3,11H2,1H3,(H,18,19) |
| InChIKey | KVMMOTBTWSRYBT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|