C29H18N4O4 — CID 88944894
(Z)-3-[4-[N-[4-[(E)-2-carboxy-2-cyanoethenyl]phenyl]-4-(2-isocyanoethenyl)anilino]phenyl]-2-cyanoprop-2-enoic acid (PubChem CID 88944894) has the molecular formula C29H18N4O4 and a molecular weight of 486.49 g/mol. Its IUPAC name is (Z)-3-[4-[N-[4-[(E)-2-carboxy-2-cyanoethenyl]phenyl]-4-(2-isocyanoethenyl)anilino]phenyl]-2-cyanoprop-2-enoic acid.
| Compound Name | (Z)-3-[4-[N-[4-[(E)-2-carboxy-2-cyanoethenyl]phenyl]-4-(2-isocyanoethenyl)anilino]phenyl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 88944894 |
| Molecular Formula | C29H18N4O4 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | (Z)-3-[4-[N-[4-[(E)-2-carboxy-2-cyanoethenyl]phenyl]-4-(2-isocyanoethenyl)anilino]phenyl]-2-cyanoprop-2-enoic acid |
| SMILES | [C-]#[N+]C=Cc1ccc(N(c2ccc(/C=C(/C#N)C(=O)O)cc2)c2ccc(/C=C(\C#N)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C29H18N4O4/c1-32-15-14-20-2-8-25(9-3-20)33(26-10-4-21(5-11-26)16-23(18-30)28(34)35)27-12-6-22(7-13-27)17-24(19-31)29(36)37/h2-17H,(H,34,35)(H,36,37)/b15-14?,23-16-,24-17+ |
| InChIKey | UTGPNONLMNBYTO-MVCXMCPPSA-N |
| XLogP | 6.03 |
| TPSA | 129.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|