C29H23N3O4 — CID 123205549
3-[4-[4-(2-carboxy-2-cyanoethenyl)-N-(2,4,5-trimethylphenyl)anilino]phenyl]-2-cyanoprop-2-enoic acid (PubChem CID 123205549) has the molecular formula C29H23N3O4 and a molecular weight of 477.52 g/mol. Its IUPAC name is 3-[4-[4-(2-carboxy-2-cyanoethenyl)-N-(2,4,5-trimethylphenyl)anilino]phenyl]-2-cyanoprop-2-enoic acid.
| Compound Name | 3-[4-[4-(2-carboxy-2-cyanoethenyl)-N-(2,4,5-trimethylphenyl)anilino]phenyl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 123205549 |
| Molecular Formula | C29H23N3O4 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 3-[4-[4-(2-carboxy-2-cyanoethenyl)-N-(2,4,5-trimethylphenyl)anilino]phenyl]-2-cyanoprop-2-enoic acid |
| SMILES | Cc1cc(C)c(N(c2ccc(C=C(C#N)C(=O)O)cc2)c2ccc(C=C(C#N)C(=O)O)cc2)cc1C |
| InChI | InChI=1S/C29H23N3O4/c1-18-12-20(3)27(13-19(18)2)32(25-8-4-21(5-9-25)14-23(16-30)28(33)34)26-10-6-22(7-11-26)15-24(17-31)29(35)36/h4-15H,1-3H3,(H,33,34)(H,35,36) |
| InChIKey | UGJUDGDRABIICB-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|