C36H40N6O2S2 — CID 102192582
(E)-3-[4-[bis(1,3-dipropyl-2-sulfanylidenebenzimidazol-5-yl)amino]phenyl]-2-cyanoprop-2-enoic acid (PubChem CID 102192582) has the molecular formula C36H40N6O2S2 and a molecular weight of 652.89 g/mol. Its IUPAC name is (E)-3-[4-[bis(1,3-dipropyl-2-sulfanylidenebenzimidazol-5-yl)amino]phenyl]-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-[4-[bis(1,3-dipropyl-2-sulfanylidenebenzimidazol-5-yl)amino]phenyl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 102192582 |
| Molecular Formula | C36H40N6O2S2 |
| Molecular Weight | 652.89 g/mol |
| Exact Mass | 652.27 |
| IUPAC Name | (E)-3-[4-[bis(1,3-dipropyl-2-sulfanylidenebenzimidazol-5-yl)amino]phenyl]-2-cyanoprop-2-enoic acid |
| SMILES | CCCn1c(=S)n(CCC)c2cc(N(c3ccc(/C=C(\C#N)C(=O)O)cc3)c3ccc4c(c3)n(CCC)c(=S)n4CCC)ccc21 |
| InChI | InChI=1S/C36H40N6O2S2/c1-5-17-38-30-15-13-28(22-32(30)40(19-7-3)35(38)45)42(27-11-9-25(10-12-27)21-26(24-37)34(43)44)29-14-16-31-33(23-29)41(20-8-4)36(46)39(31)18-6-2/h9-16,21-23H,5-8,17-20H2,1-4H3,(H,43,44)/b26-21+ |
| InChIKey | HEQMIMYEKHCBCD-YYADALCUSA-N |
| XLogP | 9.76 |
| TPSA | 84.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.89 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|