C50H47N3O4 — CID 72579962
3-[4-[N-[4-[2,2-bis(4-pentylphenyl)ethenyl]phenyl]-4-(2-carboxy-2-cyanoethenyl)anilino]phenyl]-2-cyanoprop-2-enoic acid (PubChem CID 72579962) has the molecular formula C50H47N3O4 and a molecular weight of 753.94 g/mol. Its IUPAC name is 3-[4-[N-[4-[2,2-bis(4-pentylphenyl)ethenyl]phenyl]-4-(2-carboxy-2-cyanoethenyl)anilino]phenyl]-2-cyanoprop-2-enoic acid.
| Compound Name | 3-[4-[N-[4-[2,2-bis(4-pentylphenyl)ethenyl]phenyl]-4-(2-carboxy-2-cyanoethenyl)anilino]phenyl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 72579962 |
| Molecular Formula | C50H47N3O4 |
| Molecular Weight | 753.94 g/mol |
| Exact Mass | 753.36 |
| IUPAC Name | 3-[4-[N-[4-[2,2-bis(4-pentylphenyl)ethenyl]phenyl]-4-(2-carboxy-2-cyanoethenyl)anilino]phenyl]-2-cyanoprop-2-enoic acid |
| SMILES | CCCCCc1ccc(C(=Cc2ccc(N(c3ccc(C=C(C#N)C(=O)O)cc3)c3ccc(C=C(C#N)C(=O)O)cc3)cc2)c2ccc(CCCCC)cc2)cc1 |
| InChI | InChI=1S/C50H47N3O4/c1-3-5-7-9-36-11-21-41(22-12-36)48(42-23-13-37(14-24-42)10-8-6-4-2)33-40-19-29-47(30-20-40)53(45-25-15-38(16-26-45)31-43(34-51)49(54)55)46-27-17-39(18-28-46)32-44(35-52)50(56)57/h11-33H,3-10H2,1-2H3,(H,54,55)(H,56,57) |
| InChIKey | KOXZQYGRXFDKTK-UHFFFAOYSA-N |
| XLogP | 12.19 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.94 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|