C54H46N4O4 — CID 102312474
(E)-2-cyano-3-[4-[4-[2,5-dibutyl-3,6-dioxo-4-[4-[4-(N-phenylanilino)phenyl]phenyl]pyrrolo[3,4-c]pyrrol-1-yl]phenyl]phenyl]prop-2-enoic acid (PubChem CID 102312474) has the molecular formula C54H46N4O4 and a molecular weight of 814.99 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-[4-[2,5-dibutyl-3,6-dioxo-4-[4-[4-(N-phenylanilino)phenyl]phenyl]pyrrolo[3,4-c]pyrrol-1-yl]phenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[4-[4-[2,5-dibutyl-3,6-dioxo-4-[4-[4-(N-phenylanilino)phenyl]phenyl]pyrrolo[3,4-c]pyrrol-1-yl]phenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102312474 |
| Molecular Formula | C54H46N4O4 |
| Molecular Weight | 814.99 g/mol |
| Exact Mass | 814.35 |
| IUPAC Name | (E)-2-cyano-3-[4-[4-[2,5-dibutyl-3,6-dioxo-4-[4-[4-(N-phenylanilino)phenyl]phenyl]pyrrolo[3,4-c]pyrrol-1-yl]phenyl]phenyl]prop-2-enoic acid |
| SMILES | CCCCN1C(=O)C2=C(c3ccc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)cc3)N(CCCC)C(=O)C2=C1c1ccc(-c2ccc(/C=C(\C#N)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C54H46N4O4/c1-3-5-33-56-50(42-25-21-39(22-26-42)38-19-17-37(18-20-38)35-44(36-55)54(61)62)48-49(53(56)60)51(57(52(48)59)34-6-4-2)43-27-23-40(24-28-43)41-29-31-47(32-30-41)58(45-13-9-7-10-14-45)46-15-11-8-12-16-46/h7-32,35H,3-6,33-34H2,1-2H3,(H,61,62)/b44-35+ |
| InChIKey | BGONTTDJBNYTIR-HJZXASKDSA-N |
| XLogP | 11.89 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.99 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|