C33H26N6O2 — CID 177430932
(Z)-2-cyano-3-[4-[4-(dimethylamino)-6-[4-(N-phenylanilino)phenyl]-1,3,5-triazin-2-yl]phenyl]prop-2-enoic acid (PubChem CID 177430932) has the molecular formula C33H26N6O2 and a molecular weight of 538.61 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-[4-(dimethylamino)-6-[4-(N-phenylanilino)phenyl]-1,3,5-triazin-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | (Z)-2-cyano-3-[4-[4-(dimethylamino)-6-[4-(N-phenylanilino)phenyl]-1,3,5-triazin-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 177430932 |
| Molecular Formula | C33H26N6O2 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | (Z)-2-cyano-3-[4-[4-(dimethylamino)-6-[4-(N-phenylanilino)phenyl]-1,3,5-triazin-2-yl]phenyl]prop-2-enoic acid |
| SMILES | CN(C)c1nc(-c2ccc(/C=C(/C#N)C(=O)O)cc2)nc(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C33H26N6O2/c1-38(2)33-36-30(24-15-13-23(14-16-24)21-26(22-34)32(40)41)35-31(37-33)25-17-19-29(20-18-25)39(27-9-5-3-6-10-27)28-11-7-4-8-12-28/h3-21H,1-2H3,(H,40,41)/b26-21- |
| InChIKey | BJTIPRVTZRJVFA-QLYXXIJNSA-N |
| XLogP | 6.73 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|