C50H33N3O4 — CID 123588310
2-cyano-3-[4-[6-[4-(2-cyano-2-formyloxyethenyl)-N-[4-(2,2-diphenylethenyl)phenyl]anilino]naphthalen-2-yl]phenyl]prop-2-enoic acid (PubChem CID 123588310) has the molecular formula C50H33N3O4 and a molecular weight of 739.83 g/mol. Its IUPAC name is 2-cyano-3-[4-[6-[4-(2-cyano-2-formyloxyethenyl)-N-[4-(2,2-diphenylethenyl)phenyl]anilino]naphthalen-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | 2-cyano-3-[4-[6-[4-(2-cyano-2-formyloxyethenyl)-N-[4-(2,2-diphenylethenyl)phenyl]anilino]naphthalen-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123588310 |
| Molecular Formula | C50H33N3O4 |
| Molecular Weight | 739.83 g/mol |
| Exact Mass | 739.25 |
| IUPAC Name | 2-cyano-3-[4-[6-[4-(2-cyano-2-formyloxyethenyl)-N-[4-(2,2-diphenylethenyl)phenyl]anilino]naphthalen-2-yl]phenyl]prop-2-enoic acid |
| SMILES | N#CC(=Cc1ccc(N(c2ccc(C=C(c3ccccc3)c3ccccc3)cc2)c2ccc3cc(-c4ccc(C=C(C#N)C(=O)O)cc4)ccc3c2)cc1)OC=O |
| InChI | InChI=1S/C50H33N3O4/c51-32-44(50(55)56)27-35-11-17-38(18-12-35)41-19-20-43-31-47(26-21-42(43)30-41)53(45-22-13-36(14-23-45)28-48(33-52)57-34-54)46-24-15-37(16-25-46)29-49(39-7-3-1-4-8-39)40-9-5-2-6-10-40/h1-31,34H,(H,55,56) |
| InChIKey | ABYARJASAPZKDP-UHFFFAOYSA-N |
| XLogP | 11.59 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.83 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|