C52H43N3O2 — CID 123460665
2-cyano-3-[4-[2-[4-[N-(3,4-dimethylphenyl)-4-[4-(N-(2,4-dimethylphenyl)anilino)phenyl]anilino]phenyl]ethenyl]phenyl]prop-2-enoic acid (PubChem CID 123460665) has the molecular formula C52H43N3O2 and a molecular weight of 741.94 g/mol. Its IUPAC name is 2-cyano-3-[4-[2-[4-[N-(3,4-dimethylphenyl)-4-[4-(N-(2,4-dimethylphenyl)anilino)phenyl]anilino]phenyl]ethenyl]phenyl]prop-2-enoic acid.
| Compound Name | 2-cyano-3-[4-[2-[4-[N-(3,4-dimethylphenyl)-4-[4-(N-(2,4-dimethylphenyl)anilino)phenyl]anilino]phenyl]ethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123460665 |
| Molecular Formula | C52H43N3O2 |
| Molecular Weight | 741.94 g/mol |
| Exact Mass | 741.34 |
| IUPAC Name | 2-cyano-3-[4-[2-[4-[N-(3,4-dimethylphenyl)-4-[4-(N-(2,4-dimethylphenyl)anilino)phenyl]anilino]phenyl]ethenyl]phenyl]prop-2-enoic acid |
| SMILES | Cc1ccc(N(c2ccccc2)c2ccc(-c3ccc(N(c4ccc(C=Cc5ccc(C=C(C#N)C(=O)O)cc5)cc4)c4ccc(C)c(C)c4)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C52H43N3O2/c1-36-10-31-51(39(4)32-36)55(46-8-6-5-7-9-46)49-29-22-44(23-30-49)43-20-27-48(28-21-43)54(50-24-11-37(2)38(3)33-50)47-25-18-41(19-26-47)13-12-40-14-16-42(17-15-40)34-45(35-53)52(56)57/h5-34H,1-4H3,(H,56,57) |
| InChIKey | YPVMDXPVBKSPJA-UHFFFAOYSA-N |
| XLogP | 13.69 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.94 |
| LogP ≤ 5 | 13.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|