C50H41N3O2S — CID 123941874
(Z)-3-[5-[(E)-2-[4-[N-(2,4-dimethylphenyl)-4-[4-(N-(2,4-dimethylphenyl)anilino)phenyl]anilino]phenyl]ethenyl]thiophen-2-yl]-2-isocyanoprop-2-enoic acid (PubChem CID 123941874) has the molecular formula C50H41N3O2S and a molecular weight of 747.96 g/mol. Its IUPAC name is (Z)-3-[5-[(E)-2-[4-[N-(2,4-dimethylphenyl)-4-[4-(N-(2,4-dimethylphenyl)anilino)phenyl]anilino]phenyl]ethenyl]thiophen-2-yl]-2-isocyanoprop-2-enoic acid.
| Compound Name | (Z)-3-[5-[(E)-2-[4-[N-(2,4-dimethylphenyl)-4-[4-(N-(2,4-dimethylphenyl)anilino)phenyl]anilino]phenyl]ethenyl]thiophen-2-yl]-2-isocyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 123941874 |
| Molecular Formula | C50H41N3O2S |
| Molecular Weight | 747.96 g/mol |
| Exact Mass | 747.29 |
| IUPAC Name | (Z)-3-[5-[(E)-2-[4-[N-(2,4-dimethylphenyl)-4-[4-(N-(2,4-dimethylphenyl)anilino)phenyl]anilino]phenyl]ethenyl]thiophen-2-yl]-2-isocyanoprop-2-enoic acid |
| SMILES | [C-]#[N+]/C(=C\c1ccc(/C=C/c2ccc(N(c3ccc(-c4ccc(N(c5ccccc5)c5ccc(C)cc5C)cc4)cc3)c3ccc(C)cc3C)cc2)s1)C(=O)O |
| InChI | InChI=1S/C50H41N3O2S/c1-34-11-29-48(36(3)31-34)52(41-9-7-6-8-10-41)43-22-16-39(17-23-43)40-18-24-44(25-19-40)53(49-30-12-35(2)32-37(49)4)42-20-13-38(14-21-42)15-26-45-27-28-46(56-45)33-47(51-5)50(54)55/h6-33H,1-4H3,(H,54,55)/b26-15+,47-33- |
| InChIKey | UNQDQMKORXIXCK-NZZPZWEASA-N |
| XLogP | 14.10 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.96 |
| LogP ≤ 5 | 14.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|