C38H27N3O2S — CID 59685468
(Z)-2-isocyano-3-[5-[4-(N-[4-(N-phenylanilino)phenyl]anilino)phenyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 59685468) has the molecular formula C38H27N3O2S and a molecular weight of 589.72 g/mol. Its IUPAC name is (Z)-2-isocyano-3-[5-[4-(N-[4-(N-phenylanilino)phenyl]anilino)phenyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (Z)-2-isocyano-3-[5-[4-(N-[4-(N-phenylanilino)phenyl]anilino)phenyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 59685468 |
| Molecular Formula | C38H27N3O2S |
| Molecular Weight | 589.72 g/mol |
| Exact Mass | 589.18 |
| IUPAC Name | (Z)-2-isocyano-3-[5-[4-(N-[4-(N-phenylanilino)phenyl]anilino)phenyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | [C-]#[N+]/C(=C\c1ccc(-c2ccc(N(c3ccccc3)c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc2)s1)C(=O)O |
| InChI | InChI=1S/C38H27N3O2S/c1-39-36(38(42)43)27-35-25-26-37(44-35)28-17-19-32(20-18-28)41(31-15-9-4-10-16-31)34-23-21-33(22-24-34)40(29-11-5-2-6-12-29)30-13-7-3-8-14-30/h2-27H,(H,42,43)/b36-27- |
| InChIKey | XYKGJJKMWFUGCQ-RLANJUCJSA-N |
| XLogP | 10.70 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.72 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|