C46H35N3O2S — CID 163823446
(Z)-2-cyano-3-[5-[4-(N-[2-methyl-4-[3-methyl-4-(N-phenylanilino)phenyl]phenyl]anilino)phenyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 163823446) has the molecular formula C46H35N3O2S and a molecular weight of 693.87 g/mol. Its IUPAC name is (Z)-2-cyano-3-[5-[4-(N-[2-methyl-4-[3-methyl-4-(N-phenylanilino)phenyl]phenyl]anilino)phenyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (Z)-2-cyano-3-[5-[4-(N-[2-methyl-4-[3-methyl-4-(N-phenylanilino)phenyl]phenyl]anilino)phenyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 163823446 |
| Molecular Formula | C46H35N3O2S |
| Molecular Weight | 693.87 g/mol |
| Exact Mass | 693.24 |
| IUPAC Name | (Z)-2-cyano-3-[5-[4-(N-[2-methyl-4-[3-methyl-4-(N-phenylanilino)phenyl]phenyl]anilino)phenyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | Cc1cc(-c2ccc(N(c3ccccc3)c3ccc(-c4ccc(/C=C(/C#N)C(=O)O)s4)cc3)c(C)c2)ccc1N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C46H35N3O2S/c1-32-28-35(20-25-43(32)48(38-12-6-3-7-13-38)39-14-8-4-9-15-39)36-21-26-44(33(2)29-36)49(40-16-10-5-11-17-40)41-22-18-34(19-23-41)45-27-24-42(52-45)30-37(31-47)46(50)51/h3-30H,1-2H3,(H,50,51)/b37-30- |
| InChIKey | NXJUNCSDICQRPP-ONQIKCEGSA-N |
| XLogP | 12.63 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.87 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|