C41H35N3O2S — CID 118336793
(E)-2-cyano-3-[5-[4-[2-(diethylamino)-4-(N-naphthalen-2-ylanilino)phenyl]-3-methylphenyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 118336793) has the molecular formula C41H35N3O2S and a molecular weight of 633.82 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[4-[2-(diethylamino)-4-(N-naphthalen-2-ylanilino)phenyl]-3-methylphenyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[4-[2-(diethylamino)-4-(N-naphthalen-2-ylanilino)phenyl]-3-methylphenyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118336793 |
| Molecular Formula | C41H35N3O2S |
| Molecular Weight | 633.82 g/mol |
| Exact Mass | 633.24 |
| IUPAC Name | (E)-2-cyano-3-[5-[4-[2-(diethylamino)-4-(N-naphthalen-2-ylanilino)phenyl]-3-methylphenyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | CCN(CC)c1cc(N(c2ccccc2)c2ccc3ccccc3c2)ccc1-c1ccc(-c2ccc(/C=C(\C#N)C(=O)O)s2)cc1C |
| InChI | InChI=1S/C41H35N3O2S/c1-4-43(5-2)39-26-35(44(33-13-7-6-8-14-33)34-17-15-29-11-9-10-12-30(29)24-34)18-21-38(39)37-20-16-31(23-28(37)3)40-22-19-36(47-40)25-32(27-42)41(45)46/h6-26H,4-5H2,1-3H3,(H,45,46)/b32-25+ |
| InChIKey | FASHAOROGDFDQC-WGPBWIAQSA-N |
| XLogP | 10.85 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.82 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|