C27H22N2O4S — CID 141355021
2-cyano-3-[5-[4-[7-(diethylamino)-2-oxochromen-3-yl]phenyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 141355021) has the molecular formula C27H22N2O4S and a molecular weight of 470.55 g/mol. Its IUPAC name is 2-cyano-3-[5-[4-[7-(diethylamino)-2-oxochromen-3-yl]phenyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | 2-cyano-3-[5-[4-[7-(diethylamino)-2-oxochromen-3-yl]phenyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 141355021 |
| Molecular Formula | C27H22N2O4S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 2-cyano-3-[5-[4-[7-(diethylamino)-2-oxochromen-3-yl]phenyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | CCN(CC)c1ccc2cc(-c3ccc(-c4ccc(C=C(C#N)C(=O)O)s4)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C27H22N2O4S/c1-3-29(4-2)21-10-9-19-14-23(27(32)33-24(19)15-21)17-5-7-18(8-6-17)25-12-11-22(34-25)13-20(16-28)26(30)31/h5-15H,3-4H2,1-2H3,(H,30,31) |
| InChIKey | SNKFNGSBIRMQTD-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|