C29H24N2O5S3 — CID 102144276
2-[(5Z)-5-[[5-[4-[7-(diethylamino)-2-oxochromen-3-yl]phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 102144276) has the molecular formula C29H24N2O5S3 and a molecular weight of 576.72 g/mol. Its IUPAC name is 2-[(5Z)-5-[[5-[4-[7-(diethylamino)-2-oxochromen-3-yl]phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-5-[[5-[4-[7-(diethylamino)-2-oxochromen-3-yl]phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 102144276 |
| Molecular Formula | C29H24N2O5S3 |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.08 |
| IUPAC Name | 2-[(5Z)-5-[[5-[4-[7-(diethylamino)-2-oxochromen-3-yl]phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCN(CC)c1ccc2cc(-c3ccc(-c4ccc(/C=C5\SC(=S)N(CC(=O)O)C5=O)s4)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C29H24N2O5S3/c1-3-30(4-2)20-10-9-19-13-22(28(35)36-23(19)14-20)17-5-7-18(8-6-17)24-12-11-21(38-24)15-25-27(34)31(16-26(32)33)29(37)39-25/h5-15H,3-4,16H2,1-2H3,(H,32,33)/b25-15- |
| InChIKey | WGWVMSTZCYEJFU-MYYYXRDXSA-N |
| XLogP | 6.32 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|