C29H33N3O5S — CID 122682891
(E)-2-cyano-3-[5-[6-(diethylamino)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4R,5R)-3,4,6-trihydroxy-5-methyloxan-2-yl]methyl]prop-2-enamide (PubChem CID 122682891) has the molecular formula C29H33N3O5S and a molecular weight of 535.67 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[6-(diethylamino)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4R,5R)-3,4,6-trihydroxy-5-methyloxan-2-yl]methyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[5-[6-(diethylamino)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4R,5R)-3,4,6-trihydroxy-5-methyloxan-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 122682891 |
| Molecular Formula | C29H33N3O5S |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | (E)-2-cyano-3-[5-[6-(diethylamino)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4R,5R)-3,4,6-trihydroxy-5-methyloxan-2-yl]methyl]prop-2-enamide |
| SMILES | CCN(CC)c1ccc2cc(-c3ccc(/C=C(\C#N)C(=O)NC[C@H]4OC(O)[C@H](C)[C@@H](O)[C@@H]4O)s3)ccc2c1 |
| InChI | InChI=1S/C29H33N3O5S/c1-4-32(5-2)22-9-8-18-12-20(7-6-19(18)13-22)25-11-10-23(38-25)14-21(15-30)28(35)31-16-24-27(34)26(33)17(3)29(36)37-24/h6-14,17,24,26-27,29,33-34,36H,4-5,16H2,1-3H3,(H,31,35)/b21-14+/t17-,24-,26-,27-,29?/m1/s1 |
| InChIKey | CRAVQHVEDBDEQW-AFCCKPNVSA-N |
| XLogP | 3.51 |
| TPSA | 126.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|