C24H29N3O5 — CID 166868642
(E)-2-cyano-3-[6-(diethylamino)naphthalen-2-yl]-N-[[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]methyl]prop-2-enamide (PubChem CID 166868642) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is (E)-2-cyano-3-[6-(diethylamino)naphthalen-2-yl]-N-[[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]methyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[6-(diethylamino)naphthalen-2-yl]-N-[[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 166868642 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | (E)-2-cyano-3-[6-(diethylamino)naphthalen-2-yl]-N-[[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]methyl]prop-2-enamide |
| SMILES | CCN(CC)c1ccc2cc(/C=C(\C#N)C(=O)NC[C@H]3OC[C@H](O)[C@@H](O)[C@@H]3O)ccc2c1 |
| InChI | InChI=1S/C24H29N3O5/c1-3-27(4-2)19-8-7-16-9-15(5-6-17(16)11-19)10-18(12-25)24(31)26-13-21-23(30)22(29)20(28)14-32-21/h5-11,20-23,28-30H,3-4,13-14H2,1-2H3,(H,26,31)/b18-10+/t20-,21+,22+,23+/m0/s1 |
| InChIKey | KEEMMIADRSXGFC-AGKSFAIRSA-N |
| XLogP | 1.19 |
| TPSA | 126.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|