C31H37N3O6 — CID 130375191
(E)-2-cyano-3-[5-[6-(dipropylamino)naphthalen-2-yl]furan-2-yl]-N-[[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]methyl]but-2-enamide (PubChem CID 130375191) has the molecular formula C31H37N3O6 and a molecular weight of 547.65 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[6-(dipropylamino)naphthalen-2-yl]furan-2-yl]-N-[[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]methyl]but-2-enamide.
| Compound Name | (E)-2-cyano-3-[5-[6-(dipropylamino)naphthalen-2-yl]furan-2-yl]-N-[[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]methyl]but-2-enamide |
|---|---|
| PubChem CID | 130375191 |
| Molecular Formula | C31H37N3O6 |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | (E)-2-cyano-3-[5-[6-(dipropylamino)naphthalen-2-yl]furan-2-yl]-N-[[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]methyl]but-2-enamide |
| SMILES | CCCN(CCC)c1ccc2cc(-c3ccc(/C(C)=C(\C#N)C(=O)NC[C@H]4OC[C@H](O)[C@@H](O)[C@@H]4O)o3)ccc2c1 |
| InChI | InChI=1S/C31H37N3O6/c1-4-12-34(13-5-2)23-9-8-20-14-22(7-6-21(20)15-23)27-11-10-26(40-27)19(3)24(16-32)31(38)33-17-28-30(37)29(36)25(35)18-39-28/h6-11,14-15,25,28-30,35-37H,4-5,12-13,17-18H2,1-3H3,(H,33,38)/b24-19+/t25-,28+,29+,30+/m0/s1 |
| InChIKey | ZPGXAIBFZGVEJN-INEJMIKWSA-N |
| XLogP | 3.62 |
| TPSA | 139.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|