C30H33N3O6 — CID 123240835
2-cyano-3-[5-(6-piperidin-1-ylnaphthalen-2-yl)furan-2-yl]-N-[(3,4,5-trihydroxyoxan-2-yl)methyl]but-2-enamide (PubChem CID 123240835) has the molecular formula C30H33N3O6 and a molecular weight of 531.61 g/mol. Its IUPAC name is 2-cyano-3-[5-(6-piperidin-1-ylnaphthalen-2-yl)furan-2-yl]-N-[(3,4,5-trihydroxyoxan-2-yl)methyl]but-2-enamide.
| Compound Name | 2-cyano-3-[5-(6-piperidin-1-ylnaphthalen-2-yl)furan-2-yl]-N-[(3,4,5-trihydroxyoxan-2-yl)methyl]but-2-enamide |
|---|---|
| PubChem CID | 123240835 |
| Molecular Formula | C30H33N3O6 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | 2-cyano-3-[5-(6-piperidin-1-ylnaphthalen-2-yl)furan-2-yl]-N-[(3,4,5-trihydroxyoxan-2-yl)methyl]but-2-enamide |
| SMILES | CC(=C(C#N)C(=O)NCC1OCC(O)C(O)C1O)c1ccc(-c2ccc3cc(N4CCCCC4)ccc3c2)o1 |
| InChI | InChI=1S/C30H33N3O6/c1-18(23(15-31)30(37)32-16-27-29(36)28(35)24(34)17-38-27)25-9-10-26(39-25)21-6-5-20-14-22(8-7-19(20)13-21)33-11-3-2-4-12-33/h5-10,13-14,24,27-29,34-36H,2-4,11-12,16-17H2,1H3,(H,32,37) |
| InChIKey | KVJZJAZUVIAEBJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 139.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|