C24H29N3O6S — CID 153371587
(E)-1-cyano-2-(6-piperidin-1-ylnaphthalen-2-yl)-N-[[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]methyl]ethenesulfonamide (PubChem CID 153371587) has the molecular formula C24H29N3O6S and a molecular weight of 487.58 g/mol. Its IUPAC name is (E)-1-cyano-2-(6-piperidin-1-ylnaphthalen-2-yl)-N-[[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]methyl]ethenesulfonamide.
| Compound Name | (E)-1-cyano-2-(6-piperidin-1-ylnaphthalen-2-yl)-N-[[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 153371587 |
| Molecular Formula | C24H29N3O6S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | (E)-1-cyano-2-(6-piperidin-1-ylnaphthalen-2-yl)-N-[[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]methyl]ethenesulfonamide |
| SMILES | N#C/C(=C\c1ccc2cc(N3CCCCC3)ccc2c1)S(=O)(=O)NC[C@H]1OC[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H29N3O6S/c25-13-20(34(31,32)26-14-22-24(30)23(29)21(28)15-33-22)11-16-4-5-18-12-19(7-6-17(18)10-16)27-8-2-1-3-9-27/h4-7,10-12,21-24,26,28-30H,1-3,8-9,14-15H2/b20-11+/t21-,22+,23+,24+/m0/s1 |
| InChIKey | GQPDDEIHANPSEX-PDOZFLIRSA-N |
| XLogP | 1.10 |
| TPSA | 143.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|