C29H39FN6O6 — CID 144928098
(E)-N-[(Z)-2-amino-3-[amino-[(3,4,5-trihydroxyoxan-2-yl)methyl]amino]prop-2-enyl]-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enamide;methyl hypofluorite (PubChem CID 144928098) has the molecular formula C29H39FN6O6 and a molecular weight of 586.67 g/mol. Its IUPAC name is (E)-N-[(Z)-2-amino-3-[amino-[(3,4,5-trihydroxyoxan-2-yl)methyl]amino]prop-2-enyl]-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enamide;methyl hypofluorite.
| Compound Name | (E)-N-[(Z)-2-amino-3-[amino-[(3,4,5-trihydroxyoxan-2-yl)methyl]amino]prop-2-enyl]-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enamide;methyl hypofluorite |
|---|---|
| PubChem CID | 144928098 |
| Molecular Formula | C29H39FN6O6 |
| Molecular Weight | 586.67 g/mol |
| Exact Mass | 586.29 |
| IUPAC Name | (E)-N-[(Z)-2-amino-3-[amino-[(3,4,5-trihydroxyoxan-2-yl)methyl]amino]prop-2-enyl]-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enamide;methyl hypofluorite |
| SMILES | COF.N#C/C(=C\c1ccc2cc(N3CCCCC3)ccc2c1)C(=O)NC/C(N)=C/N(N)CC1OCC(O)C(O)C1O |
| InChI | InChI=1S/C28H36N6O5.CH3FO/c29-13-21(11-18-4-5-20-12-23(7-6-19(20)10-18)33-8-2-1-3-9-33)28(38)32-14-22(30)15-34(31)16-25-27(37)26(36)24(35)17-39-25;1-3-2/h4-7,10-12,15,24-27,35-37H,1-3,8-9,14,16-17,30-31H2,(H,32,38);1H3/b21-11+,22-15-; |
| InChIKey | NZWZEVFSTXXQQF-QQBRFBFKSA-N |
| XLogP | 0.83 |
| TPSA | 190.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.67 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|