C21H27N3O5 — CID 118401180
(E)-2-cyano-N-[(3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]-3-(4-piperidin-1-ylphenyl)prop-2-enamide (PubChem CID 118401180) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is (E)-2-cyano-N-[(3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]-3-(4-piperidin-1-ylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[(3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]-3-(4-piperidin-1-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 118401180 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | (E)-2-cyano-N-[(3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]-3-(4-piperidin-1-ylphenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(N2CCCCC2)cc1)C(=O)N[C@H]1CO[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H27N3O5/c22-11-15(21(28)23-17-13-29-18(12-25)20(27)19(17)26)10-14-4-6-16(7-5-14)24-8-2-1-3-9-24/h4-7,10,17-20,25-27H,1-3,8-9,12-13H2,(H,23,28)/b15-10+/t17-,18+,19+,20+/m0/s1 |
| InChIKey | RZLFMCJTTXOYEH-UUVKMAFLSA-N |
| XLogP | 0.18 |
| TPSA | 126.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|