C26H33N4O5S+ — CID 123418061
2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)-N-[(3,4,6-trihydroxy-4-methyl-5-sulfanyl-1,4-oxazepan-4-ium-7-yl)methyl]prop-2-enamide (PubChem CID 123418061) has the molecular formula C26H33N4O5S+ and a molecular weight of 513.64 g/mol. Its IUPAC name is 2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)-N-[(3,4,6-trihydroxy-4-methyl-5-sulfanyl-1,4-oxazepan-4-ium-7-yl)methyl]prop-2-enamide.
| Compound Name | 2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)-N-[(3,4,6-trihydroxy-4-methyl-5-sulfanyl-1,4-oxazepan-4-ium-7-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 123418061 |
| Molecular Formula | C26H33N4O5S+ |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | 2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)-N-[(3,4,6-trihydroxy-4-methyl-5-sulfanyl-1,4-oxazepan-4-ium-7-yl)methyl]prop-2-enamide |
| SMILES | C[N+]1(O)C(O)COC(CNC(=O)C(C#N)=Cc2ccc3cc(N4CCCCC4)ccc3c2)C(O)C1S |
| InChI | InChI=1S/C26H32N4O5S/c1-30(34)23(31)16-35-22(24(32)26(30)36)15-28-25(33)20(14-27)12-17-5-6-19-13-21(8-7-18(19)11-17)29-9-3-2-4-10-29/h5-8,11-13,22-24,26,31-32,34H,2-4,9-10,15-16H2,1H3,(H-,28,33,36)/p+1 |
| InChIKey | FMPBMPHUZBYEDX-UHFFFAOYSA-O |
| XLogP | 2.02 |
| TPSA | 126.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|