C27H33N3O4 — CID 122683059
(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)-N-[[(1R)-2,3,5-trihydroxy-4-methylcyclohexyl]methyl]prop-2-enamide (PubChem CID 122683059) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is (E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)-N-[[(1R)-2,3,5-trihydroxy-4-methylcyclohexyl]methyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)-N-[[(1R)-2,3,5-trihydroxy-4-methylcyclohexyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 122683059 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | (E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)-N-[[(1R)-2,3,5-trihydroxy-4-methylcyclohexyl]methyl]prop-2-enamide |
| SMILES | CC1C(O)C[C@H](CNC(=O)/C(C#N)=C/c2ccc3cc(N4CCCCC4)ccc3c2)C(O)C1O |
| InChI | InChI=1S/C27H33N3O4/c1-17-24(31)14-22(26(33)25(17)32)16-29-27(34)21(15-28)12-18-5-6-20-13-23(8-7-19(20)11-18)30-9-3-2-4-10-30/h5-8,11-13,17,22,24-26,31-33H,2-4,9-10,14,16H2,1H3,(H,29,34)/b21-12+/t17?,22-,24?,25?,26?/m1/s1 |
| InChIKey | YPQIULAPKVWMKW-UIFMQOPRSA-N |
| XLogP | 2.59 |
| TPSA | 116.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|