C25H32N3O7P — CID 147371129
2-[2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethoxy]ethyl dihydrogen phosphate (PubChem CID 147371129) has the molecular formula C25H32N3O7P and a molecular weight of 517.52 g/mol. Its IUPAC name is 2-[2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethoxy]ethyl dihydrogen phosphate.
| Compound Name | 2-[2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethoxy]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 147371129 |
| Molecular Formula | C25H32N3O7P |
| Molecular Weight | 517.52 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 2-[2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethoxy]ethyl dihydrogen phosphate |
| SMILES | N#C/C(=C\c1ccc2cc(N3CCCCC3)ccc2c1)C(=O)NCCOCCOCCOP(=O)(O)O |
| InChI | InChI=1S/C25H32N3O7P/c26-19-23(25(29)27-8-11-33-12-13-34-14-15-35-36(30,31)32)17-20-4-5-22-18-24(7-6-21(22)16-20)28-9-2-1-3-10-28/h4-7,16-18H,1-3,8-15H2,(H,27,29)(H2,30,31,32)/b23-17+ |
| InChIKey | DJCRCRAZFOELEN-HAVVHWLPSA-N |
| XLogP | 3.00 |
| TPSA | 141.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|