C34H46N4O8 — CID 177047727
2-[2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethoxy]ethyl (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 177047727) has the molecular formula C34H46N4O8 and a molecular weight of 638.76 g/mol. Its IUPAC name is 2-[2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethoxy]ethyl (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | 2-[2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethoxy]ethyl (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 177047727 |
| Molecular Formula | C34H46N4O8 |
| Molecular Weight | 638.76 g/mol |
| Exact Mass | 638.33 |
| IUPAC Name | 2-[2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethoxy]ethyl (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(O)[C@H](NC(=O)OC(C)(C)C)C(=O)OCCOCCOCCNC(=O)/C(C#N)=C/c1ccc2cc(N3CCCCC3)ccc2c1 |
| InChI | InChI=1S/C34H46N4O8/c1-24(39)30(37-33(42)46-34(2,3)4)32(41)45-19-18-44-17-16-43-15-12-36-31(40)28(23-35)21-25-8-9-27-22-29(11-10-26(27)20-25)38-13-6-5-7-14-38/h8-11,20-22,24,30,39H,5-7,12-19H2,1-4H3,(H,36,40)(H,37,42)/b28-21+/t24?,30-/m0/s1 |
| InChIKey | MQLYORWQBGRHHM-GZPVUHEZSA-N |
| XLogP | 3.70 |
| TPSA | 159.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.76 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|