C33H42N4O8 — CID 177047684
5-[2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethoxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (PubChem CID 177047684) has the molecular formula C33H42N4O8 and a molecular weight of 622.72 g/mol. Its IUPAC name is 5-[2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethoxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid.
| Compound Name | 5-[2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethoxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 177047684 |
| Molecular Formula | C33H42N4O8 |
| Molecular Weight | 622.72 g/mol |
| Exact Mass | 622.30 |
| IUPAC Name | 5-[2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethoxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)CC(=O)OCCOCCNC(=O)/C(C#N)=C/c1ccc2cc(N3CCCCC3)ccc2c1 |
| InChI | InChI=1S/C33H42N4O8/c1-33(2,3)45-32(42)36-27(20-29(38)39)21-30(40)44-16-15-43-14-11-35-31(41)26(22-34)18-23-7-8-25-19-28(10-9-24(25)17-23)37-12-5-4-6-13-37/h7-10,17-19,27H,4-6,11-16,20-21H2,1-3H3,(H,35,41)(H,36,42)(H,38,39)/b26-18+ |
| InChIKey | FJIVIBUQBAGBPK-NLRVBDNBSA-N |
| XLogP | 4.17 |
| TPSA | 167.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.72 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|