C32H36N4O4 — CID 177047624
2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethyl (3R)-3-amino-3-phenylpropanoate (PubChem CID 177047624) has the molecular formula C32H36N4O4 and a molecular weight of 540.66 g/mol. Its IUPAC name is 2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethyl (3R)-3-amino-3-phenylpropanoate.
| Compound Name | 2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethyl (3R)-3-amino-3-phenylpropanoate |
|---|---|
| PubChem CID | 177047624 |
| Molecular Formula | C32H36N4O4 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | 2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethyl (3R)-3-amino-3-phenylpropanoate |
| SMILES | N#C/C(=C\c1ccc2cc(N3CCCCC3)ccc2c1)C(=O)NCCOCCOC(=O)C[C@@H](N)c1ccccc1 |
| InChI | InChI=1S/C32H36N4O4/c33-23-28(20-24-9-10-27-21-29(12-11-26(27)19-24)36-14-5-2-6-15-36)32(38)35-13-16-39-17-18-40-31(37)22-30(34)25-7-3-1-4-8-25/h1,3-4,7-12,19-21,30H,2,5-6,13-18,22,34H2,(H,35,38)/b28-20+/t30-/m1/s1 |
| InChIKey | VVRDBHXLLSQDMC-JUNLCRQGSA-N |
| XLogP | 4.50 |
| TPSA | 117.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|