C31H43N5O5 — CID 177047710
2-[2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethoxy]ethyl (2S)-2,6-diaminohexanoate (PubChem CID 177047710) has the molecular formula C31H43N5O5 and a molecular weight of 565.72 g/mol. Its IUPAC name is 2-[2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethoxy]ethyl (2S)-2,6-diaminohexanoate.
| Compound Name | 2-[2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethoxy]ethyl (2S)-2,6-diaminohexanoate |
|---|---|
| PubChem CID | 177047710 |
| Molecular Formula | C31H43N5O5 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.33 |
| IUPAC Name | 2-[2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethoxy]ethyl (2S)-2,6-diaminohexanoate |
| SMILES | N#C/C(=C\c1ccc2cc(N3CCCCC3)ccc2c1)C(=O)NCCOCCOCCOC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C31H43N5O5/c32-11-3-2-6-29(34)31(38)41-19-18-40-17-16-39-15-12-35-30(37)27(23-33)21-24-7-8-26-22-28(10-9-25(26)20-24)36-13-4-1-5-14-36/h7-10,20-22,29H,1-6,11-19,32,34H2,(H,35,37)/b27-21+/t29-/m0/s1 |
| InChIKey | AUFDJRXMRJBHRH-JGDSNHNJSA-N |
| XLogP | 2.89 |
| TPSA | 152.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|