C32H38N3O7P — CID 166038764
benzyl 2-[2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethoxy]ethyl hydrogen phosphate (PubChem CID 166038764) has the molecular formula C32H38N3O7P and a molecular weight of 607.64 g/mol. Its IUPAC name is benzyl 2-[2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethoxy]ethyl hydrogen phosphate.
| Compound Name | benzyl 2-[2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethoxy]ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 166038764 |
| Molecular Formula | C32H38N3O7P |
| Molecular Weight | 607.64 g/mol |
| Exact Mass | 607.24 |
| IUPAC Name | benzyl 2-[2-[2-[[(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoyl]amino]ethoxy]ethoxy]ethyl hydrogen phosphate |
| SMILES | N#C/C(=C\c1ccc2cc(N3CCCCC3)ccc2c1)C(=O)NCCOCCOCCOP(=O)(O)OCc1ccccc1 |
| InChI | InChI=1S/C32H38N3O7P/c33-24-30(22-27-9-10-29-23-31(12-11-28(29)21-27)35-14-5-2-6-15-35)32(36)34-13-16-39-17-18-40-19-20-41-43(37,38)42-25-26-7-3-1-4-8-26/h1,3-4,7-12,21-23H,2,5-6,13-20,25H2,(H,34,36)(H,37,38)/b30-22+ |
| InChIKey | PEHDRHKLQIMUIK-JBASAIQMSA-N |
| XLogP | 5.22 |
| TPSA | 130.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.64 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|