C29H31N3O6 — CID 123984652
2-cyano-3-[5-(6-piperidin-1-ylnaphthalen-2-yl)furan-2-yl]-N-[(3,4,5-trihydroxyoxan-2-yl)methyl]prop-2-enamide (PubChem CID 123984652) has the molecular formula C29H31N3O6 and a molecular weight of 517.58 g/mol. Its IUPAC name is 2-cyano-3-[5-(6-piperidin-1-ylnaphthalen-2-yl)furan-2-yl]-N-[(3,4,5-trihydroxyoxan-2-yl)methyl]prop-2-enamide.
| Compound Name | 2-cyano-3-[5-(6-piperidin-1-ylnaphthalen-2-yl)furan-2-yl]-N-[(3,4,5-trihydroxyoxan-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 123984652 |
| Molecular Formula | C29H31N3O6 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | 2-cyano-3-[5-(6-piperidin-1-ylnaphthalen-2-yl)furan-2-yl]-N-[(3,4,5-trihydroxyoxan-2-yl)methyl]prop-2-enamide |
| SMILES | N#CC(=Cc1ccc(-c2ccc3cc(N4CCCCC4)ccc3c2)o1)C(=O)NCC1OCC(O)C(O)C1O |
| InChI | InChI=1S/C29H31N3O6/c30-15-21(29(36)31-16-26-28(35)27(34)24(33)17-37-26)14-23-8-9-25(38-23)20-5-4-19-13-22(7-6-18(19)12-20)32-10-2-1-3-11-32/h4-9,12-14,24,26-28,33-35H,1-3,10-11,16-17H2,(H,31,36) |
| InChIKey | JTKMJFXEZCVUDV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 139.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|