C29H34N6O6 — CID 118384256
(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)-N-[[1-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]triazol-4-yl]methyl]prop-2-enamide (PubChem CID 118384256) has the molecular formula C29H34N6O6 and a molecular weight of 562.63 g/mol. Its IUPAC name is (E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)-N-[[1-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]triazol-4-yl]methyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)-N-[[1-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]triazol-4-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 118384256 |
| Molecular Formula | C29H34N6O6 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | (E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)-N-[[1-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]triazol-4-yl]methyl]prop-2-enamide |
| SMILES | CO[C@H]1O[C@H](Cn2cc(CNC(=O)/C(C#N)=C/c3ccc4cc(N5CCCCC5)ccc4c3)nn2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C29H34N6O6/c1-40-29-27(38)26(37)25(36)24(41-29)17-35-16-22(32-33-35)15-31-28(39)21(14-30)12-18-5-6-20-13-23(8-7-19(20)11-18)34-9-3-2-4-10-34/h5-8,11-13,16,24-27,29,36-38H,2-4,9-10,15,17H2,1H3,(H,31,39)/b21-12+/t24-,25-,26+,27-,29+/m1/s1 |
| InChIKey | KBBXMRWJFDKQCA-NOACQDQKSA-N |
| XLogP | 1.10 |
| TPSA | 165.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|