C31H34N6O6 — CID 118384279
4-(6-piperidin-1-ylnaphthalen-2-yl)-2-[[1-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]triazol-4-yl]methoxy]pyridine-3-carbonitrile (PubChem CID 118384279) has the molecular formula C31H34N6O6 and a molecular weight of 586.65 g/mol. Its IUPAC name is 4-(6-piperidin-1-ylnaphthalen-2-yl)-2-[[1-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]triazol-4-yl]methoxy]pyridine-3-carbonitrile.
| Compound Name | 4-(6-piperidin-1-ylnaphthalen-2-yl)-2-[[1-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]triazol-4-yl]methoxy]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 118384279 |
| Molecular Formula | C31H34N6O6 |
| Molecular Weight | 586.65 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | 4-(6-piperidin-1-ylnaphthalen-2-yl)-2-[[1-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]triazol-4-yl]methoxy]pyridine-3-carbonitrile |
| SMILES | CO[C@H]1O[C@H](Cn2cc(COc3nccc(-c4ccc5cc(N6CCCCC6)ccc5c4)c3C#N)nn2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C31H34N6O6/c1-41-31-29(40)28(39)27(38)26(43-31)17-37-16-22(34-35-37)18-42-30-25(15-32)24(9-10-33-30)21-6-5-20-14-23(8-7-19(20)13-21)36-11-3-2-4-12-36/h5-10,13-14,16,26-29,31,38-40H,2-4,11-12,17-18H2,1H3/t26-,27-,28+,29-,31+/m1/s1 |
| InChIKey | OLPONTOQXFNJGH-KBMGTAGUSA-N |
| XLogP | 2.39 |
| TPSA | 159.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.65 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |