C31H38N2O4 — CID 123978524
3-ethyl-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-6-(6-piperidin-1-ylnaphthalen-2-yl)benzonitrile (PubChem CID 123978524) has the molecular formula C31H38N2O4 and a molecular weight of 502.66 g/mol. Its IUPAC name is 3-ethyl-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-6-(6-piperidin-1-ylnaphthalen-2-yl)benzonitrile.
| Compound Name | 3-ethyl-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-6-(6-piperidin-1-ylnaphthalen-2-yl)benzonitrile |
|---|---|
| PubChem CID | 123978524 |
| Molecular Formula | C31H38N2O4 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | 3-ethyl-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-6-(6-piperidin-1-ylnaphthalen-2-yl)benzonitrile |
| SMILES | CCc1ccc(-c2ccc3cc(N4CCCCC4)ccc3c2)c(C#N)c1OCCOCCOCCOC |
| InChI | InChI=1S/C31H38N2O4/c1-3-24-10-12-29(30(23-32)31(24)37-20-19-36-18-17-35-16-15-34-2)27-8-7-26-22-28(11-9-25(26)21-27)33-13-5-4-6-14-33/h7-12,21-22H,3-6,13-20H2,1-2H3 |
| InChIKey | YHYWWMDPODCMAW-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 63.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|