C24H24N2O — CID 102382833
3-methoxy-2-methyl-4-naphthalen-2-yl-6-piperidin-1-ylbenzonitrile (PubChem CID 102382833) has the molecular formula C24H24N2O and a molecular weight of 356.47 g/mol. Its IUPAC name is 3-methoxy-2-methyl-4-naphthalen-2-yl-6-piperidin-1-ylbenzonitrile.
| Compound Name | 3-methoxy-2-methyl-4-naphthalen-2-yl-6-piperidin-1-ylbenzonitrile |
|---|---|
| PubChem CID | 102382833 |
| Molecular Formula | C24H24N2O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 3-methoxy-2-methyl-4-naphthalen-2-yl-6-piperidin-1-ylbenzonitrile |
| SMILES | COc1c(-c2ccc3ccccc3c2)cc(N2CCCCC2)c(C#N)c1C |
| InChI | InChI=1S/C24H24N2O/c1-17-22(16-25)23(26-12-6-3-7-13-26)15-21(24(17)27-2)20-11-10-18-8-4-5-9-19(18)14-20/h4-5,8-11,14-15H,3,6-7,12-13H2,1-2H3 |
| InChIKey | CTKYWDYFJDWHET-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|