C25H23ClN2O — CID 11711116
4-(4-chlorophenyl)-3-methoxy-2-phenyl-6-piperidin-1-ylbenzonitrile (PubChem CID 11711116) has the molecular formula C25H23ClN2O and a molecular weight of 402.93 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-3-methoxy-2-phenyl-6-piperidin-1-ylbenzonitrile.
| Compound Name | 4-(4-chlorophenyl)-3-methoxy-2-phenyl-6-piperidin-1-ylbenzonitrile |
|---|---|
| PubChem CID | 11711116 |
| Molecular Formula | C25H23ClN2O |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 4-(4-chlorophenyl)-3-methoxy-2-phenyl-6-piperidin-1-ylbenzonitrile |
| SMILES | COc1c(-c2ccc(Cl)cc2)cc(N2CCCCC2)c(C#N)c1-c1ccccc1 |
| InChI | InChI=1S/C25H23ClN2O/c1-29-25-21(18-10-12-20(26)13-11-18)16-23(28-14-6-3-7-15-28)22(17-27)24(25)19-8-4-2-5-9-19/h2,4-5,8-13,16H,3,6-7,14-15H2,1H3 |
| InChIKey | LOUJBTAWLOHZNB-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|