C27H25NO3 — CID 135052987
7-methoxy-6,8-diphenyl-2-piperidin-1-ylchromen-4-one (PubChem CID 135052987) has the molecular formula C27H25NO3 and a molecular weight of 411.50 g/mol. Its IUPAC name is 7-methoxy-6,8-diphenyl-2-piperidin-1-ylchromen-4-one.
| Compound Name | 7-methoxy-6,8-diphenyl-2-piperidin-1-ylchromen-4-one |
|---|---|
| PubChem CID | 135052987 |
| Molecular Formula | C27H25NO3 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 7-methoxy-6,8-diphenyl-2-piperidin-1-ylchromen-4-one |
| SMILES | COc1c(-c2ccccc2)cc2c(=O)cc(N3CCCCC3)oc2c1-c1ccccc1 |
| InChI | InChI=1S/C27H25NO3/c1-30-26-21(19-11-5-2-6-12-19)17-22-23(29)18-24(28-15-9-4-10-16-28)31-27(22)25(26)20-13-7-3-8-14-20/h2-3,5-8,11-14,17-18H,4,9-10,15-16H2,1H3 |
| InChIKey | WTMQRFHHVMPYTM-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |