C16H20N2O4 — CID 12730612
5,8-dimethoxy-2-(4-methylpiperazin-1-yl)chromen-4-one (PubChem CID 12730612) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 5,8-dimethoxy-2-(4-methylpiperazin-1-yl)chromen-4-one.
| Compound Name | 5,8-dimethoxy-2-(4-methylpiperazin-1-yl)chromen-4-one |
|---|---|
| PubChem CID | 12730612 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 5,8-dimethoxy-2-(4-methylpiperazin-1-yl)chromen-4-one |
| SMILES | COc1ccc(OC)c2c(=O)cc(N3CCN(C)CC3)oc12 |
| InChI | InChI=1S/C16H20N2O4/c1-17-6-8-18(9-7-17)14-10-11(19)15-12(20-2)4-5-13(21-3)16(15)22-14/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | QARKYDWRGJBWJL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |