C12H12O4S — CID 134910868
5,8-dimethoxy-2-methylsulfanylchromen-4-one (PubChem CID 134910868) has the molecular formula C12H12O4S and a molecular weight of 252.29 g/mol. Its IUPAC name is 5,8-dimethoxy-2-methylsulfanylchromen-4-one.
| Compound Name | 5,8-dimethoxy-2-methylsulfanylchromen-4-one |
|---|---|
| PubChem CID | 134910868 |
| Molecular Formula | C12H12O4S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 5,8-dimethoxy-2-methylsulfanylchromen-4-one |
| SMILES | COc1ccc(OC)c2c(=O)cc(SC)oc12 |
| InChI | InChI=1S/C12H12O4S/c1-14-8-4-5-9(15-2)12-11(8)7(13)6-10(16-12)17-3/h4-6H,1-3H3 |
| InChIKey | TUSRLBDBZVZZJW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |